C11H12BrFO4S — CID 66115474
3-[(2-bromo-4-fluorophenyl)methylsulfonyl]butanoic acid (PubChem CID 66115474) has the molecular formula C11H12BrFO4S and a molecular weight of 339.18 g/mol. Its IUPAC name is 3-[(2-bromo-4-fluorophenyl)methylsulfonyl]butanoic acid.
| Compound Name | 3-[(2-bromo-4-fluorophenyl)methylsulfonyl]butanoic acid |
|---|---|
| PubChem CID | 66115474 |
| Molecular Formula | C11H12BrFO4S |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 3-[(2-bromo-4-fluorophenyl)methylsulfonyl]butanoic acid |
| SMILES | CC(CC(=O)O)S(=O)(=O)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C11H12BrFO4S/c1-7(4-11(14)15)18(16,17)6-8-2-3-9(13)5-10(8)12/h2-3,5,7H,4,6H2,1H3,(H,14,15) |
| InChIKey | IRTOFQACVBFUEW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |