C12H14BrFO2 — CID 81004360
4-(2-bromo-4-fluorophenyl)-3,3-dimethylbutanoic acid (PubChem CID 81004360) has the molecular formula C12H14BrFO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is 4-(2-bromo-4-fluorophenyl)-3,3-dimethylbutanoic acid.
| Compound Name | 4-(2-bromo-4-fluorophenyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 81004360 |
| Molecular Formula | C12H14BrFO2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-(2-bromo-4-fluorophenyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C12H14BrFO2/c1-12(2,7-11(15)16)6-8-3-4-9(14)5-10(8)13/h3-5H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | XLLWSZZALUAPSD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |