C11H12BrFO2S — CID 66138492
3-[(2-bromo-4-fluorophenyl)methylsulfanyl]butanoic acid (PubChem CID 66138492) has the molecular formula C11H12BrFO2S and a molecular weight of 307.18 g/mol. Its IUPAC name is 3-[(2-bromo-4-fluorophenyl)methylsulfanyl]butanoic acid.
| Compound Name | 3-[(2-bromo-4-fluorophenyl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 66138492 |
| Molecular Formula | C11H12BrFO2S |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 3-[(2-bromo-4-fluorophenyl)methylsulfanyl]butanoic acid |
| SMILES | CC(CC(=O)O)SCc1ccc(F)cc1Br |
| InChI | InChI=1S/C11H12BrFO2S/c1-7(4-11(14)15)16-6-8-2-3-9(13)5-10(8)12/h2-3,5,7H,4,6H2,1H3,(H,14,15) |
| InChIKey | IEFJPBVBRMWDHT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |