C12H12BrFO2 — CID 102639583
2-[(2-bromo-4-fluorophenyl)methyl]-2-methylbut-3-enoic acid (PubChem CID 102639583) has the molecular formula C12H12BrFO2 and a molecular weight of 287.13 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)methyl]-2-methylbut-3-enoic acid.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)methyl]-2-methylbut-3-enoic acid |
|---|---|
| PubChem CID | 102639583 |
| Molecular Formula | C12H12BrFO2 |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)methyl]-2-methylbut-3-enoic acid |
| SMILES | C=CC(C)(Cc1ccc(F)cc1Br)C(=O)O |
| InChI | InChI=1S/C12H12BrFO2/c1-3-12(2,11(15)16)7-8-4-5-9(14)6-10(8)13/h3-6H,1,7H2,2H3,(H,15,16) |
| InChIKey | GFRAGXWDGANIAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|