C13H17BrFNO2 — CID 55122575
3-[(2-bromo-4-fluorophenyl)methyl-ethylamino]-2-methylpropanoic acid (PubChem CID 55122575) has the molecular formula C13H17BrFNO2 and a molecular weight of 318.19 g/mol. Its IUPAC name is 3-[(2-bromo-4-fluorophenyl)methyl-ethylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(2-bromo-4-fluorophenyl)methyl-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 55122575 |
| Molecular Formula | C13H17BrFNO2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-[(2-bromo-4-fluorophenyl)methyl-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(Cc1ccc(F)cc1Br)CC(C)C(=O)O |
| InChI | InChI=1S/C13H17BrFNO2/c1-3-16(7-9(2)13(17)18)8-10-4-5-11(15)6-12(10)14/h4-6,9H,3,7-8H2,1-2H3,(H,17,18) |
| InChIKey | KRWXUDPNQVTANJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |