C13H18BrFN2O2 — CID 107425936
2-[(2-bromo-4-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid (PubChem CID 107425936) has the molecular formula C13H18BrFN2O2 and a molecular weight of 333.20 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 107425936 |
| Molecular Formula | C13H18BrFN2O2 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C13H18BrFN2O2/c1-16(2)5-6-17(9-13(18)19)8-10-3-4-11(15)7-12(10)14/h3-4,7H,5-6,8-9H2,1-2H3,(H,18,19) |
| InChIKey | UOYWLIINSLEHCM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |