C12H16BrFN2O4S — CID 103862497
2-[(2-bromo-4-fluorophenyl)sulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid (PubChem CID 103862497) has the molecular formula C12H16BrFN2O4S and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)sulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)sulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 103862497 |
| Molecular Formula | C12H16BrFN2O4S |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)sulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)S(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C12H16BrFN2O4S/c1-15(2)5-6-16(8-12(17)18)21(19,20)11-4-3-9(14)7-10(11)13/h3-4,7H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | UZRDWXWWUQUGLH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |