C16H22BrFN2O3S — CID 86879612
2-[(2-bromo-4-fluorophenyl)sulfonyl-(2-cyclohexylethyl)amino]acetamide (PubChem CID 86879612) has the molecular formula C16H22BrFN2O3S and a molecular weight of 421.33 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)sulfonyl-(2-cyclohexylethyl)amino]acetamide.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)sulfonyl-(2-cyclohexylethyl)amino]acetamide |
|---|---|
| PubChem CID | 86879612 |
| Molecular Formula | C16H22BrFN2O3S |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)sulfonyl-(2-cyclohexylethyl)amino]acetamide |
| SMILES | NC(=O)CN(CCC1CCCCC1)S(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C16H22BrFN2O3S/c17-14-10-13(18)6-7-15(14)24(22,23)20(11-16(19)21)9-8-12-4-2-1-3-5-12/h6-7,10,12H,1-5,8-9,11H2,(H2,19,21) |
| InChIKey | BWHMBWRDLOFICU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |