C10H13FN4O4S — CID 62921884
2-[(2-amino-5-fluorophenyl)sulfonyl-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 62921884) has the molecular formula C10H13FN4O4S and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[(2-amino-5-fluorophenyl)sulfonyl-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[(2-amino-5-fluorophenyl)sulfonyl-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 62921884 |
| Molecular Formula | C10H13FN4O4S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[(2-amino-5-fluorophenyl)sulfonyl-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)S(=O)(=O)c1cc(F)ccc1N |
| InChI | InChI=1S/C10H13FN4O4S/c11-6-1-2-7(12)8(3-6)20(18,19)15(4-9(13)16)5-10(14)17/h1-3H,4-5,12H2,(H2,13,16)(H2,14,17) |
| InChIKey | GETLDVNTOYOWPK-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|