C11H14F4N2O2S — CID 61106619
2-amino-5-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 61106619) has the molecular formula C11H14F4N2O2S and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-amino-5-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-amino-5-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61106619 |
| Molecular Formula | C11H14F4N2O2S |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-amino-5-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)c1cc(F)ccc1N |
| InChI | InChI=1S/C11H14F4N2O2S/c1-2-5-17(7-11(13,14)15)20(18,19)10-6-8(12)3-4-9(10)16/h3-4,6H,2,5,7,16H2,1H3 |
| InChIKey | REENZONIISBQJP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|