C10H12F4N2O2S — CID 55006792
2-amino-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 55006792) has the molecular formula C10H12F4N2O2S and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-amino-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-amino-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55006792 |
| Molecular Formula | C10H12F4N2O2S |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-amino-N-ethyl-4-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CCN(CC(F)(F)F)S(=O)(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C10H12F4N2O2S/c1-2-16(6-10(12,13)14)19(17,18)9-4-3-7(11)5-8(9)15/h3-5H,2,6,15H2,1H3 |
| InChIKey | VELPALOQBUSGHF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|