C13H19N3O3S — CID 79382438
2-amino-4-cyano-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide (PubChem CID 79382438) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-amino-4-cyano-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide.
| Compound Name | 2-amino-4-cyano-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79382438 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-amino-4-cyano-N-ethyl-N-(2-hydroxy-2-methylpropyl)benzenesulfonamide |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)c1ccc(C#N)cc1N |
| InChI | InChI=1S/C13H19N3O3S/c1-4-16(9-13(2,3)17)20(18,19)12-6-5-10(8-14)7-11(12)15/h5-7,17H,4,9,15H2,1-3H3 |
| InChIKey | BJAZYAJMLLDPLX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|