C11H12BrF4NO2S — CID 107492914
N-(2-bromoethyl)-5-fluoro-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 107492914) has the molecular formula C11H12BrF4NO2S and a molecular weight of 378.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-5-fluoro-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-5-fluoro-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107492914 |
| Molecular Formula | C11H12BrF4NO2S |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | N-(2-bromoethyl)-5-fluoro-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C11H12BrF4NO2S/c1-8-2-3-9(13)6-10(8)20(18,19)17(5-4-12)7-11(14,15)16/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | JHFLOUOWHRYIIA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|