C10H9BrF5NO2S — CID 107492988
N-(2-bromoethyl)-3,4-difluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 107492988) has the molecular formula C10H9BrF5NO2S and a molecular weight of 382.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-3,4-difluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-3,4-difluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107492988 |
| Molecular Formula | C10H9BrF5NO2S |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | N-(2-bromoethyl)-3,4-difluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C10H9BrF5NO2S/c11-3-4-17(6-10(14,15)16)20(18,19)7-1-2-8(12)9(13)5-7/h1-2,5H,3-4,6H2 |
| InChIKey | JEIPMDCWFPZGMY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|