C12H14BrF4NO2S — CID 103697346
4-bromo-N-butyl-3-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 103697346) has the molecular formula C12H14BrF4NO2S and a molecular weight of 392.21 g/mol. Its IUPAC name is 4-bromo-N-butyl-3-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-butyl-3-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103697346 |
| Molecular Formula | C12H14BrF4NO2S |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 4-bromo-N-butyl-3-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CCCCN(CC(F)(F)F)S(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H14BrF4NO2S/c1-2-3-6-18(8-12(15,16)17)21(19,20)9-4-5-10(13)11(14)7-9/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | JZBULFOEPZOKQA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |