C14H21BrFNO3S — CID 103834154
4-bromo-3-fluoro-N-hexyl-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 103834154) has the molecular formula C14H21BrFNO3S and a molecular weight of 382.30 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-hexyl-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-bromo-3-fluoro-N-hexyl-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103834154 |
| Molecular Formula | C14H21BrFNO3S |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 4-bromo-3-fluoro-N-hexyl-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCCCCCN(CCO)S(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C14H21BrFNO3S/c1-2-3-4-5-8-17(9-10-18)21(19,20)12-6-7-13(15)14(16)11-12/h6-7,11,18H,2-5,8-10H2,1H3 |
| InChIKey | JFWOZWHNQUFQNL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|