C12H17BrClNO3S — CID 106546170
3-bromo-N-butyl-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 106546170) has the molecular formula C12H17BrClNO3S and a molecular weight of 370.70 g/mol. Its IUPAC name is 3-bromo-N-butyl-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 3-bromo-N-butyl-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106546170 |
| Molecular Formula | C12H17BrClNO3S |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 3-bromo-N-butyl-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCCCN(CCO)S(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H17BrClNO3S/c1-2-3-6-15(7-8-16)19(17,18)10-4-5-12(14)11(13)9-10/h4-5,9,16H,2-3,6-8H2,1H3 |
| InChIKey | FZPTYAXCMWCPSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |