C11H13ClNO6S- — CID 4577559
5-[bis(2-hydroxyethyl)sulfamoyl]-2-chlorobenzoate (PubChem CID 4577559) has the molecular formula C11H13ClNO6S- and a molecular weight of 322.75 g/mol. Its IUPAC name is 5-[bis(2-hydroxyethyl)sulfamoyl]-2-chlorobenzoate.
| Compound Name | 5-[bis(2-hydroxyethyl)sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 4577559 |
| Molecular Formula | C11H13ClNO6S- |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 5-[bis(2-hydroxyethyl)sulfamoyl]-2-chlorobenzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)N(CCO)CCO)ccc1Cl |
| InChI | InChI=1S/C11H14ClNO6S/c12-10-2-1-8(7-9(10)11(16)17)20(18,19)13(3-5-14)4-6-15/h1-2,7,14-15H,3-6H2,(H,16,17)/p-1 |
| InChIKey | ATUMKQZRVIADJJ-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |