C10H11ClNO5S- — CID 7470552
4-chloro-3-[2-hydroxyethyl(methyl)sulfamoyl]benzoate (PubChem CID 7470552) has the molecular formula C10H11ClNO5S- and a molecular weight of 292.72 g/mol. Its IUPAC name is 4-chloro-3-[2-hydroxyethyl(methyl)sulfamoyl]benzoate.
| Compound Name | 4-chloro-3-[2-hydroxyethyl(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7470552 |
| Molecular Formula | C10H11ClNO5S- |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 4-chloro-3-[2-hydroxyethyl(methyl)sulfamoyl]benzoate |
| SMILES | CN(CCO)S(=O)(=O)c1cc(C(=O)[O-])ccc1Cl |
| InChI | InChI=1S/C10H12ClNO5S/c1-12(4-5-13)18(16,17)9-6-7(10(14)15)2-3-8(9)11/h2-3,6,13H,4-5H2,1H3,(H,14,15)/p-1 |
| InChIKey | MMFXZGDUIQNFHU-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |