C12H16ClNO6S2 — CID 55905314
methyl 3-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-methylamino]propanoate (PubChem CID 55905314) has the molecular formula C12H16ClNO6S2 and a molecular weight of 369.85 g/mol. Its IUPAC name is methyl 3-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-methylamino]propanoate.
| Compound Name | methyl 3-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-methylamino]propanoate |
|---|---|
| PubChem CID | 55905314 |
| Molecular Formula | C12H16ClNO6S2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | methyl 3-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C12H16ClNO6S2/c1-14(7-6-12(15)20-2)22(18,19)11-8-9(21(3,16)17)4-5-10(11)13/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | NGMVTMBYHSKBNQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |