C12H17N3O5S — CID 81466282
methyl 3-[(2-amino-4-carbamoylphenyl)sulfonyl-methylamino]propanoate (PubChem CID 81466282) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is methyl 3-[(2-amino-4-carbamoylphenyl)sulfonyl-methylamino]propanoate.
| Compound Name | methyl 3-[(2-amino-4-carbamoylphenyl)sulfonyl-methylamino]propanoate |
|---|---|
| PubChem CID | 81466282 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | methyl 3-[(2-amino-4-carbamoylphenyl)sulfonyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)c1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C12H17N3O5S/c1-15(6-5-11(16)20-2)21(18,19)10-4-3-8(12(14)17)7-9(10)13/h3-4,7H,5-6,13H2,1-2H3,(H2,14,17) |
| InChIKey | BTDBTCNDHBTIKQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|