C14H21NO4S — CID 60715387
methyl 4-[(2,4-dimethylphenyl)sulfonyl-methylamino]butanoate (PubChem CID 60715387) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is methyl 4-[(2,4-dimethylphenyl)sulfonyl-methylamino]butanoate.
| Compound Name | methyl 4-[(2,4-dimethylphenyl)sulfonyl-methylamino]butanoate |
|---|---|
| PubChem CID | 60715387 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 4-[(2,4-dimethylphenyl)sulfonyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)S(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H21NO4S/c1-11-7-8-13(12(2)10-11)20(17,18)15(3)9-5-6-14(16)19-4/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | CIIDYHAIIVFQPY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |