C14H20N2O6S — CID 39666496
methyl 4-[(2,3-dimethyl-5-nitrophenyl)sulfonyl-methylamino]butanoate (PubChem CID 39666496) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 4-[(2,3-dimethyl-5-nitrophenyl)sulfonyl-methylamino]butanoate.
| Compound Name | methyl 4-[(2,3-dimethyl-5-nitrophenyl)sulfonyl-methylamino]butanoate |
|---|---|
| PubChem CID | 39666496 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl 4-[(2,3-dimethyl-5-nitrophenyl)sulfonyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)S(=O)(=O)c1cc([N+](=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C14H20N2O6S/c1-10-8-12(16(18)19)9-13(11(10)2)23(20,21)15(3)7-5-6-14(17)22-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | DECYWNLJNFZNEO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|