C15H18N2O4S2 — CID 51249162
N,2,3-trimethyl-N-[(3-methylthiophen-2-yl)methyl]-5-nitrobenzenesulfonamide (PubChem CID 51249162) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N,2,3-trimethyl-N-[(3-methylthiophen-2-yl)methyl]-5-nitrobenzenesulfonamide.
| Compound Name | N,2,3-trimethyl-N-[(3-methylthiophen-2-yl)methyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 51249162 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N,2,3-trimethyl-N-[(3-methylthiophen-2-yl)methyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccsc1CN(C)S(=O)(=O)c1cc([N+](=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C15H18N2O4S2/c1-10-5-6-22-14(10)9-16(4)23(20,21)15-8-13(17(18)19)7-11(2)12(15)3/h5-8H,9H2,1-4H3 |
| InChIKey | HDJIQNJGASRSSF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|