C13H15NO4S3 — CID 102748355
4-methyl-3-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 102748355) has the molecular formula C13H15NO4S3 and a molecular weight of 345.47 g/mol. Its IUPAC name is 4-methyl-3-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102748355 |
| Molecular Formula | C13H15NO4S3 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4-methyl-3-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1ccsc1CN(C)S(=O)(=O)c1c(C)csc1C(=O)O |
| InChI | InChI=1S/C13H15NO4S3/c1-8-4-5-19-10(8)6-14(3)21(17,18)12-9(2)7-20-11(12)13(15)16/h4-5,7H,6H2,1-3H3,(H,15,16) |
| InChIKey | MBKQXOCREWCPIU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |