C12H19NO5S2 — CID 102748996
3-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]-4-methylthiophene-2-carboxylic acid (PubChem CID 102748996) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102748996 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]-4-methylthiophene-2-carboxylic acid |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)c1c(C)csc1C(=O)O |
| InChI | InChI=1S/C12H19NO5S2/c1-5-13(7-12(3,4)16)20(17,18)10-8(2)6-19-9(10)11(14)15/h6,16H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | DZWPQZSBECPXFT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |