C12H19NO5S2 — CID 102748537
methyl 3-[ethyl(2-methoxyethyl)sulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 102748537) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 3-[ethyl(2-methoxyethyl)sulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[ethyl(2-methoxyethyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102748537 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | methyl 3-[ethyl(2-methoxyethyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | CCN(CCOC)S(=O)(=O)c1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C12H19NO5S2/c1-5-13(6-7-17-3)20(15,16)11-9(2)8-19-10(11)12(14)18-4/h8H,5-7H2,1-4H3 |
| InChIKey | FWNQIZGWBIGAIA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |