C14H17NO4S2 — CID 102749118
methyl 3-[cyclopropylmethyl(prop-2-ynyl)sulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 102749118) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is methyl 3-[cyclopropylmethyl(prop-2-ynyl)sulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[cyclopropylmethyl(prop-2-ynyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749118 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | methyl 3-[cyclopropylmethyl(prop-2-ynyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | C#CCN(CC1CC1)S(=O)(=O)c1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C14H17NO4S2/c1-4-7-15(8-11-5-6-11)21(17,18)13-10(2)9-20-12(13)14(16)19-3/h1,9,11H,5-8H2,2-3H3 |
| InChIKey | FIIGILGOFOJTAT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|