C11H17NO5S2 — CID 114230128
methyl 3-[3-hydroxypropyl(methyl)sulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 114230128) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 3-[3-hydroxypropyl(methyl)sulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[3-hydroxypropyl(methyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 114230128 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | methyl 3-[3-hydroxypropyl(methyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)N(C)CCCO |
| InChI | InChI=1S/C11H17NO5S2/c1-8-7-18-9(11(14)17-3)10(8)19(15,16)12(2)5-4-6-13/h7,13H,4-6H2,1-3H3 |
| InChIKey | XYZOJJPMJVLXAL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |