C13H21NO5S2 — CID 102749163
methyl 3-[2-methoxyethyl(propan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 102749163) has the molecular formula C13H21NO5S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is methyl 3-[2-methoxyethyl(propan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[2-methoxyethyl(propan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749163 |
| Molecular Formula | C13H21NO5S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl 3-[2-methoxyethyl(propan-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | COCCN(C(C)C)S(=O)(=O)c1c(C)csc1C(=O)OC |
| InChI | InChI=1S/C13H21NO5S2/c1-9(2)14(6-7-18-4)21(16,17)12-10(3)8-20-11(12)13(15)19-5/h8-9H,6-7H2,1-5H3 |
| InChIKey | JPYQEEBECJTJCW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |