C12H19NO4S3 — CID 102749197
methyl 4-methyl-3-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 102749197) has the molecular formula C12H19NO4S3 and a molecular weight of 337.49 g/mol. Its IUPAC name is methyl 4-methyl-3-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749197 |
| Molecular Formula | C12H19NO4S3 |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | methyl 4-methyl-3-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)N(C)C(C)CSC |
| InChI | InChI=1S/C12H19NO4S3/c1-8-6-19-10(12(14)17-4)11(8)20(15,16)13(3)9(2)7-18-5/h6,9H,7H2,1-5H3 |
| InChIKey | SROGATFYVUDZMY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |