C11H18ClNO3S2 — CID 103100248
5-chloro-N-ethyl-N-(2-hydroxy-2-methylpropyl)-4-methylthiophene-2-sulfonamide (PubChem CID 103100248) has the molecular formula C11H18ClNO3S2 and a molecular weight of 311.86 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-(2-hydroxy-2-methylpropyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-ethyl-N-(2-hydroxy-2-methylpropyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100248 |
| Molecular Formula | C11H18ClNO3S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-chloro-N-ethyl-N-(2-hydroxy-2-methylpropyl)-4-methylthiophene-2-sulfonamide |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C11H18ClNO3S2/c1-5-13(7-11(3,4)14)18(15,16)9-6-8(2)10(12)17-9/h6,14H,5,7H2,1-4H3 |
| InChIKey | BMFCALMRPYZEOY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |