C13H21ClN2O3S2 — CID 103100214
1-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropan-2-ol (PubChem CID 103100214) has the molecular formula C13H21ClN2O3S2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 1-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 103100214 |
| Molecular Formula | C13H21ClN2O3S2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropan-2-ol |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(CC(C)(C)O)CC2)sc1Cl |
| InChI | InChI=1S/C13H21ClN2O3S2/c1-10-8-11(20-12(10)14)21(18,19)16-6-4-15(5-7-16)9-13(2,3)17/h8,17H,4-7,9H2,1-3H3 |
| InChIKey | HFJQRZHLSILSNK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |