C13H18ClN3O2S2 — CID 103099962
2-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile (PubChem CID 103099962) has the molecular formula C13H18ClN3O2S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile.
| Compound Name | 2-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 103099962 |
| Molecular Formula | C13H18ClN3O2S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-[4-(5-chloro-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(C(C)(C)C#N)CC2)sc1Cl |
| InChI | InChI=1S/C13H18ClN3O2S2/c1-10-8-11(20-12(10)14)21(18,19)17-6-4-16(5-7-17)13(2,3)9-15/h8H,4-7H2,1-3H3 |
| InChIKey | WFFONDAEOKMPCB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |