C12H18ClN3O3S2 — CID 107162654
1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide (PubChem CID 107162654) has the molecular formula C12H18ClN3O3S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107162654 |
| Molecular Formula | C12H18ClN3O3S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(C)(/C(N)=N/O)CC2)sc1Cl |
| InChI | InChI=1S/C12H18ClN3O3S2/c1-8-7-9(20-10(8)13)21(18,19)16-5-3-12(2,4-6-16)11(14)15-17/h7,17H,3-6H2,1-2H3,(H2,14,15) |
| InChIKey | NENIXFKCUZVAPI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|