C12H21N5O3S — CID 107162680
1-(1,2-dimethylimidazol-4-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide (PubChem CID 107162680) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-(1,2-dimethylimidazol-4-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide.
| Compound Name | 1-(1,2-dimethylimidazol-4-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107162680 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(1,2-dimethylimidazol-4-yl)sulfonyl-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
| SMILES | Cc1nc(S(=O)(=O)N2CCC(C)(C(N)=NO)CC2)cn1C |
| InChI | InChI=1S/C12H21N5O3S/c1-9-14-10(8-16(9)3)21(19,20)17-6-4-12(2,5-7-17)11(13)15-18/h8,18H,4-7H2,1-3H3,(H2,13,15) |
| InChIKey | HELXISGYOANAMY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|