C11H18N4O2S2 — CID 107161341
4-methyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine-4-carbothioamide (PubChem CID 107161341) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 4-methyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine-4-carbothioamide.
| Compound Name | 4-methyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 107161341 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-methyl-1-(1-methylimidazol-4-yl)sulfonylpiperidine-4-carbothioamide |
| SMILES | Cn1cnc(S(=O)(=O)N2CCC(C)(C(N)=S)CC2)c1 |
| InChI | InChI=1S/C11H18N4O2S2/c1-11(10(12)18)3-5-15(6-4-11)19(16,17)9-7-14(2)8-13-9/h7-8H,3-6H2,1-2H3,(H2,12,18) |
| InChIKey | QJWFJGQADYAPQE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|