C13H17ClN2O2S2 — CID 107161275
1-(4-chlorophenyl)sulfonyl-4-methylpiperidine-4-carbothioamide (PubChem CID 107161275) has the molecular formula C13H17ClN2O2S2 and a molecular weight of 332.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-methylpiperidine-4-carbothioamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-methylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 107161275 |
| Molecular Formula | C13H17ClN2O2S2 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-methylpiperidine-4-carbothioamide |
| SMILES | CC1(C(N)=S)CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C13H17ClN2O2S2/c1-13(12(15)19)6-8-16(9-7-13)20(17,18)11-4-2-10(14)3-5-11/h2-5H,6-9H2,1H3,(H2,15,19) |
| InChIKey | OHBZAOMOTXSFDZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|