C8H14N4O2S — CID 20735186
1-(1-methylimidazol-4-yl)sulfonylpiperazine (PubChem CID 20735186) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-(1-methylimidazol-4-yl)sulfonylpiperazine.
| Compound Name | 1-(1-methylimidazol-4-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 20735186 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-(1-methylimidazol-4-yl)sulfonylpiperazine |
| SMILES | Cn1cnc(S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C8H14N4O2S/c1-11-6-8(10-7-11)15(13,14)12-4-2-9-3-5-12/h6-7,9H,2-5H2,1H3 |
| InChIKey | WZERJKZDVDESRT-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |