C12H18Cl2N2O2S2 — CID 103100697
1-(2-chloroethyl)-4-(5-chloro-4-methylthiophen-2-yl)sulfonyl-1,4-diazepane (PubChem CID 103100697) has the molecular formula C12H18Cl2N2O2S2 and a molecular weight of 357.33 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(5-chloro-4-methylthiophen-2-yl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-(5-chloro-4-methylthiophen-2-yl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 103100697 |
| Molecular Formula | C12H18Cl2N2O2S2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-(2-chloroethyl)-4-(5-chloro-4-methylthiophen-2-yl)sulfonyl-1,4-diazepane |
| SMILES | Cc1cc(S(=O)(=O)N2CCCN(CCCl)CC2)sc1Cl |
| InChI | InChI=1S/C12H18Cl2N2O2S2/c1-10-9-11(19-12(10)14)20(17,18)16-5-2-4-15(6-3-13)7-8-16/h9H,2-8H2,1H3 |
| InChIKey | MWNHTHLGWDEPMF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|