C12H21ClN4O2S — CID 63397082
1-(2-chloroethyl)-4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,4-diazepane (PubChem CID 63397082) has the molecular formula C12H21ClN4O2S and a molecular weight of 320.85 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,4-diazepane |
|---|---|
| PubChem CID | 63397082 |
| Molecular Formula | C12H21ClN4O2S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-(2-chloroethyl)-4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,4-diazepane |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C12H21ClN4O2S/c1-10-12(11(2)15-14-10)20(18,19)17-6-3-5-16(7-4-13)8-9-17/h3-9H2,1-2H3,(H,14,15) |
| InChIKey | AWMCBCLOLKQJCJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|