C9H15N3O2S — CID 4736860
3,5-dimethyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrazole (PubChem CID 4736860) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3,5-dimethyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrazole.
| Compound Name | 3,5-dimethyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrazole |
|---|---|
| PubChem CID | 4736860 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3,5-dimethyl-4-pyrrolidin-1-ylsulfonyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C9H15N3O2S/c1-7-9(8(2)11-10-7)15(13,14)12-5-3-4-6-12/h3-6H2,1-2H3,(H,10,11) |
| InChIKey | JZSPPJHGZBWPDI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |