C8H13N3O2S2 — CID 122332190
3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,3-thiazolidine (PubChem CID 122332190) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,3-thiazolidine.
| Compound Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 122332190 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-1,3-thiazolidine |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCSC1 |
| InChI | InChI=1S/C8H13N3O2S2/c1-6-8(7(2)10-9-6)15(12,13)11-3-4-14-5-11/h3-5H2,1-2H3,(H,9,10) |
| InChIKey | ZJOWJXVAQYUCDC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |