C14H20N4O2S — CID 110721365
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-pyrrol-1-ylpiperidine (PubChem CID 110721365) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-pyrrol-1-ylpiperidine.
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-pyrrol-1-ylpiperidine |
|---|---|
| PubChem CID | 110721365 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-pyrrol-1-ylpiperidine |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(n2cccc2)CC1 |
| InChI | InChI=1S/C14H20N4O2S/c1-11-14(12(2)16-15-11)21(19,20)18-9-5-13(6-10-18)17-7-3-4-8-17/h3-4,7-8,13H,5-6,9-10H2,1-2H3,(H,15,16) |
| InChIKey | RFDGNPZJHVEUSX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |