C11H18ClN3O2S — CID 102962583
3-chloro-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylpiperidine (PubChem CID 102962583) has the molecular formula C11H18ClN3O2S and a molecular weight of 291.80 g/mol. Its IUPAC name is 3-chloro-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylpiperidine.
| Compound Name | 3-chloro-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 102962583 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-chloro-1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylpiperidine |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(C)C(Cl)C1 |
| InChI | InChI=1S/C11H18ClN3O2S/c1-7-4-5-15(6-10(7)12)18(16,17)11-8(2)13-14-9(11)3/h7,10H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | MTFFUIIDLZYXJP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|