C13H17Cl3N2O2S — CID 63397365
1-(2-chloroethyl)-4-(2,5-dichlorophenyl)sulfonyl-1,4-diazepane (PubChem CID 63397365) has the molecular formula C13H17Cl3N2O2S and a molecular weight of 371.72 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(2,5-dichlorophenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-(2,5-dichlorophenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 63397365 |
| Molecular Formula | C13H17Cl3N2O2S |
| Molecular Weight | 371.72 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 1-(2-chloroethyl)-4-(2,5-dichlorophenyl)sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C13H17Cl3N2O2S/c14-4-7-17-5-1-6-18(9-8-17)21(19,20)13-10-11(15)2-3-12(13)16/h2-3,10H,1,4-9H2 |
| InChIKey | OONIQXKOTWCRKT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|