C17H16Cl2F2N2O2S — CID 19582940
1-(2,5-dichlorophenyl)sulfonyl-4-[(2,3-difluorophenyl)methyl]piperazine (PubChem CID 19582940) has the molecular formula C17H16Cl2F2N2O2S and a molecular weight of 421.30 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-4-[(2,3-difluorophenyl)methyl]piperazine.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(2,3-difluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 19582940 |
| Molecular Formula | C17H16Cl2F2N2O2S |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(2,3-difluorophenyl)methyl]piperazine |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCN(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C17H16Cl2F2N2O2S/c18-13-4-5-14(19)16(10-13)26(24,25)23-8-6-22(7-9-23)11-12-2-1-3-15(20)17(12)21/h1-5,10H,6-9,11H2 |
| InChIKey | PTSJZARFDLWZNJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |