C19H22Cl2N2O4S — CID 6734604
1-(2,5-dichlorophenyl)sulfonyl-4-[(2,5-dimethoxyphenyl)methyl]piperazine (PubChem CID 6734604) has the molecular formula C19H22Cl2N2O4S and a molecular weight of 445.37 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-4-[(2,5-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(2,5-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 6734604 |
| Molecular Formula | C19H22Cl2N2O4S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(2,5-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(OC)c(CN2CCN(S(=O)(=O)c3cc(Cl)ccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H22Cl2N2O4S/c1-26-16-4-6-18(27-2)14(11-16)13-22-7-9-23(10-8-22)28(24,25)19-12-15(20)3-5-17(19)21/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | AMWQNGOUURUNCT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |