C22H22Cl2N2O4S — CID 4794683
4-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7-dimethylchromen-2-one (PubChem CID 4794683) has the molecular formula C22H22Cl2N2O4S and a molecular weight of 481.40 g/mol. Its IUPAC name is 4-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 4794683 |
| Molecular Formula | C22H22Cl2N2O4S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 4-[[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN(S(=O)(=O)c4cc(Cl)ccc4Cl)CC3)c2cc1C |
| InChI | InChI=1S/C22H22Cl2N2O4S/c1-14-9-18-16(11-22(27)30-20(18)10-15(14)2)13-25-5-7-26(8-6-25)31(28,29)21-12-17(23)3-4-19(21)24/h3-4,9-12H,5-8,13H2,1-2H3 |
| InChIKey | DXHOHRQXXVCZJO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|