C26H32N2O4S — CID 2486944
6,7-dimethyl-4-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one (PubChem CID 2486944) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 2486944 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 6,7-dimethyl-4-[[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN(S(=O)(=O)c4c(C)c(C)cc(C)c4C)CC3)c2cc1C |
| InChI | InChI=1S/C26H32N2O4S/c1-16-12-23-22(14-25(29)32-24(23)13-17(16)2)15-27-7-9-28(10-8-27)33(30,31)26-20(5)18(3)11-19(4)21(26)6/h11-14H,7-10,15H2,1-6H3 |
| InChIKey | UMTIXPCKDYKOIU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|